Benzene,1-(2-phenylethyl)-2-(phenylsulfonyl)-
Modify Date: 2024-01-09 21:03:11
Benzene,1-(2-phenylethyl)-2-(phenylsulfonyl)- structure
|
Common Name | Benzene,1-(2-phenylethyl)-2-(phenylsulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 16425-99-3 | Molecular Weight | 322.42100 | |
| Density | 1.188g/cm3 | Boiling Point | 485.1ºC at 760mmHg | |
| Molecular Formula | C20H18O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.3ºC | |
| Name | 1-(benzenesulfonyl)-2-(2-phenylethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 485.1ºC at 760mmHg |
| Molecular Formula | C20H18O2S |
| Molecular Weight | 322.42100 |
| Flash Point | 293.3ºC |
| Exact Mass | 322.10300 |
| PSA | 42.52000 |
| LogP | 5.38540 |
| Vapour Pressure | 4.28E-09mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | KNNUDQHTGDGPLF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccccc1CCc1ccccc1 |
|
~%
Benzene,1-(2-ph... CAS#:16425-99-3 |
| Literature: Crowther,G.P.; Hauser,C.R. Journal of Organic Chemistry, 1968 , vol. 33, # 6 p. 2228 - 2233 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(benzenesulfonyl)-2-phenethylbenzene |
| 1-(2-phenylethyl)-2-(phenylsulfonyl)benzene |
| 2-Benzolsulfonyl-dibenzyl |