1-Chloro-3-[(E)-2-(3-methoxyphenyl)vinyl]benzene
Modify Date: 2025-08-25 16:46:03
![1-Chloro-3-[(E)-2-(3-methoxyphenyl)vinyl]benzene Structure](https://image.chemsrc.com/caspic/213/164220-45-5.png)
1-Chloro-3-[(E)-2-(3-methoxyphenyl)vinyl]benzene structure
|
Common Name | 1-Chloro-3-[(E)-2-(3-methoxyphenyl)vinyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 164220-45-5 | Molecular Weight | 244.716 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 367.0±21.0 °C at 760 mmHg | |
| Molecular Formula | C15H13ClO | Melting Point | 42ºC | |
| MSDS | N/A | Flash Point | 174.8±16.1 °C | |
Use of 1-Chloro-3-[(E)-2-(3-methoxyphenyl)vinyl]benzeneSolubility in Toluene：almost transparency |
| Name | 1-chloro-3-[2-(3-methoxyphenyl)ethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.0±21.0 °C at 760 mmHg |
| Melting Point | 42ºC |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.716 |
| Flash Point | 174.8±16.1 °C |
| Exact Mass | 244.065491 |
| PSA | 9.23000 |
| LogP | 5.41 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | DXHFJXLLHMOLGG-CMDGGOBGSA-N |
| SMILES | COc1cccc(C=Cc2cccc(Cl)c2)c1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-chloro-3-[(E)-2-(3-methoxyphenyl)ethenyl]- |
| 3-[(E)-2-(3-Chlorophenyl)vinyl]phenyl methyl ether |
| 3-Chloro-3'-methoxystilbene |
| 1-Chloro-3-[(E)-2-(3-methoxyphenyl)vinyl]benzene |