2,4(1H,3H)-Pyrimidinedione,5-(methylsulfonyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,5-(methylsulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 16417-11-1 | Molecular Weight | 190.17700 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H6N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methylsulfonyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Molecular Formula | C5H6N2O4S |
| Molecular Weight | 190.17700 |
| Exact Mass | 190.00500 |
| PSA | 108.24000 |
| Index of Refraction | 1.591 |
| InChIKey | FWWCDHWPUUOPCH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methanesulfonyl-1H-pyrimidine-2,4-dione |
| 5-methyl-sulfonyluracil |
| 5-Methylsulphonyluracil |