2-((tert-Butyldimethylsilyl)oxy)ethyl trifluoromethanesulfonate
Modify Date: 2025-08-25 11:57:02
2-((tert-Butyldimethylsilyl)oxy)ethyl trifluoromethanesulfonate structure
|
Common Name | 2-((tert-Butyldimethylsilyl)oxy)ethyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 164162-36-1 | Molecular Weight | 308.39000 | |
| Density | 1.172 | Boiling Point | 253℃ | |
| Molecular Formula | C9H19F3O4SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107℃ | |
| Name | 2-((tert-Butyldimethylsilyl)oxy)ethyl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172 |
|---|---|
| Boiling Point | 253℃ |
| Molecular Formula | C9H19F3O4SSi |
| Molecular Weight | 308.39000 |
| Flash Point | 107℃ |
| Exact Mass | 308.07300 |
| PSA | 60.98000 |
| LogP | 3.95520 |
| InChIKey | DUUWFQBUGWHIMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCOS(=O)(=O)C(F)(F)F |
|
~%
2-((tert-Butyld... CAS#:164162-36-1 |
| Literature: WO2006/95185 A1, ; Page/Page column 36 ; |
|
~%
2-((tert-Butyld... CAS#:164162-36-1 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 42, # 1 p. 29 - 41 |
![2-[(tert-Butyldimethylsilyl)oxy]ethanol structure](https://image.chemsrc.com/caspic/056/102229-10-7.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-[tert-butyl(dimethyl)silyl]oxyethyl trifluoromethanesulfonate |
| Everolimus Impurity 12 |