Benzoic acid,4-chloro-, 1-(4-methoxyphenyl)hydrazide structure
|
Common Name | Benzoic acid,4-chloro-, 1-(4-methoxyphenyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 16390-07-1 | Molecular Weight | 276.71800 | |
| Density | 1.298g/cm3 | Boiling Point | 391.7ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.7ºC | |
| Name | 4-chloro-N-(4-methoxyphenyl)benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 391.7ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.71800 |
| Flash Point | 190.7ºC |
| Exact Mass | 276.06700 |
| PSA | 55.56000 |
| LogP | 3.56940 |
| Vapour Pressure | 2.42E-06mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | IURNVVIQOMTXSM-UHFFFAOYSA-N |
| SMILES | COc1ccc(N(N)C(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-(4-methoxyphenyl)hydrazide |
| N-4-methoxyphenyl-N-4-chlorobenzoyl hydrazide |
| N-(p-Chlorobenzoyl)-N-(p-methoxyphenyl)hydrazine |
| 4-chloro-1'-(4-methoxyphenyl)benzohydrazide |
| N1-(4-chlorobenzoyl)-4-methoxyphenylhydrazine |
| 4-chloro-N-(4-methoxyphenyl)-benzohydrazide |
| 1-(4-Chlorbenzoyl)-1-(4-methoxyphenyl)-hydrazin |
| 4-chloranyl-N-(4-methoxyphenyl)benzohydrazide |