tert-Butyl 2-(chloromethyl)-1H-benzo[d]imidazole-1-carboxylate
Modify Date: 2025-08-24 07:29:33
![tert-Butyl 2-(chloromethyl)-1H-benzo[d]imidazole-1-carboxylate Structure](https://image.chemsrc.com/caspic/229/163798-87-6.png)
tert-Butyl 2-(chloromethyl)-1H-benzo[d]imidazole-1-carboxylate structure
|
Common Name | tert-Butyl 2-(chloromethyl)-1H-benzo[d]imidazole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 163798-87-6 | Molecular Weight | 266.723 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 377.6±44.0 °C at 760 mmHg | |
| Molecular Formula | C13H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2±28.4 °C | |
| Name | tert-Butyl 2-(chloromethyl)-1H-benzo[d]imidazole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.6±44.0 °C at 760 mmHg |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.723 |
| Flash Point | 182.2±28.4 °C |
| Exact Mass | 266.082214 |
| PSA | 44.12000 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | YNZUHDHIWWRGOR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1c(CCl)nc2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~92%
tert-Butyl 2-(c... CAS#:163798-87-6 |
| Literature: BIOLIPOX AB Patent: WO2008/110793 A1, 2008 ; Location in patent: Page/Page column 108 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Benzimidazole-1-carboxylic acid, 2-(chloromethyl)-, 1,1-dimethylethyl ester |
| tert-butyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate |
| tert-butyl 2-(chloromethyl)benzimidazole-1-carboxylate |
| 2-Methyl-2-propanyl 2-(chloromethyl)-1H-benzimidazole-1-carboxylate |