2l5,4l5,6l5,8l5-1,3,5,7,2,4,6,8-Tetrazatetraphosphocine-2,2,4,4,6,6,8,8-octamine,N2,N4,N6,N8,N'2,N'4,N'6,N'8-octamethyl- structure
|
Common Name | 2l5,4l5,6l5,8l5-1,3,5,7,2,4,6,8-Tetrazatetraphosphocine-2,2,4,4,6,6,8,8-octamine,N2,N4,N6,N8,N'2,N'4,N'6,N'8-octamethyl- | ||
|---|---|---|---|---|
| CAS Number | 1635-65-0 | Molecular Weight | 420.31500 | |
| Density | 1.59g/cm3 | Boiling Point | 493.5ºC at 760mmHg | |
| Molecular Formula | C8H32N12P4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.3ºC | |
| Name | 2-N,2-N',4-N,4-N',6-N,6-N',8-N,8-N'-octamethyl-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,2,4,4,6,6,8,8-octamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 493.5ºC at 760mmHg |
| Molecular Formula | C8H32N12P4 |
| Molecular Weight | 420.31500 |
| Flash Point | 252.3ºC |
| Exact Mass | 420.18200 |
| PSA | 184.92000 |
| LogP | 2.40960 |
| Vapour Pressure | 7E-10mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | VJSVNDPQQDTBFX-UHFFFAOYSA-N |
| SMILES | CNP1(NC)=NP(NC)(NC)=NP(NC)(NC)=NP(NC)(NC)=N1 |
|
~69%
2l5,4l5,6l5,8l5... CAS#:1635-65-0 |
| Literature: Contractor, Sorab R.; Kilic, Zeynel; Shaw, Robert A. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1987 , p. 2023 - 2030 |
|
~%
2l5,4l5,6l5,8l5... CAS#:1635-65-0 |
| Literature: Ray,S.K. et al. Journal of the Chemical Society, 1963 , p. 3236 - 3241 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Oktakis-methylamino-cyclotetraphosphazatetraen |
| Octa-methylamino-tetraphosphornitril |
| n2,n2,n4,n4,n6,n6,n8,n8-octamethyl-1,3,5,7,2|E5,4|E5,6|E5,8|E5-tetrazatetraphosphocine-2,2,4,4,6,6,8,8-octamine |
| 2-N,2-N',4-N,4-N',6-N,6-N',8-N,8-N'-octamethyl-1,3,5,7-tetraza-2 |