2,2-dichloro-N-(4-nitrophenyl)acetamide structure
|
Common Name | 2,2-dichloro-N-(4-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 16346-60-4 | Molecular Weight | 249.05100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dichloro-N-(4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6Cl2N2O3 |
|---|---|
| Molecular Weight | 249.05100 |
| Exact Mass | 247.97600 |
| PSA | 74.92000 |
| LogP | 2.93320 |
| InChIKey | VUPKZANRZKUIHF-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C(Cl)Cl |
|
~%
2,2-dichloro-N-... CAS#:16346-60-4 |
| Literature: Votocek; Burda Chemische Berichte, 1915 , vol. 48, p. 1006 |
|
~%
2,2-dichloro-N-... CAS#:16346-60-4 |
| Literature: Wheeler; Smith Journal of the American Chemical Society, 1923 , vol. 45, p. 1841 |
|
~%
2,2-dichloro-N-... CAS#:16346-60-4 |
| Literature: Votocek; Burda Chemische Berichte, 1915 , vol. 48, p. 1006 |
|
~%
2,2-dichloro-N-... CAS#:16346-60-4 |
| Literature: Votocek; Burda Chemische Berichte, 1915 , vol. 48, p. 1006 |
| Dichlor-essigsaeure-(4-nitro-anilid) |
| N-Dichloracetyl-p-nitroanilin |
| 2,2-Dichlor-4'-nitro-acetanilid |
| Acetamide,2,2-dichloro-N-(4-nitrophenyl) |
| N-Dichloracetyl-4-nitro-anilin |
| dichloro-acetic acid-(4-nitro-anilide) |
| N-<4-Nitrophenyl>-dichloracetamid |