Arylquin-1 structure
|
Common Name | Arylquin-1 | ||
|---|---|---|---|---|
| CAS Number | 1630743-73-5 | Molecular Weight | 281.327 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 441.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H16FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7±27.3 °C | |
Use of Arylquin-1Arylquin 1, a prostate-apoptosis-response-4 (Par-4) secretagogue, targets vimentin to induce Par-4 secretion. Arylquin 1 induces non-apoptotic cell death in cancer cells through the induction of lysosomal membrane permeabilization (LMP)[1]. |
| Name | Arylquin 1 |
|---|---|
| Synonym | More Synonyms |
| Description | Arylquin 1, a prostate-apoptosis-response-4 (Par-4) secretagogue, targets vimentin to induce Par-4 secretion. Arylquin 1 induces non-apoptotic cell death in cancer cells through the induction of lysosomal membrane permeabilization (LMP)[1]. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.4±40.0 °C at 760 mmHg |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.327 |
| Flash Point | 220.7±27.3 °C |
| Exact Mass | 281.132813 |
| LogP | 4.49 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | RHAQINSYYSNKKI-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2cc(-c3ccccc3F)c(N)nc2c1 |
| RIDADR | NONH for all modes of transport |
|---|
| 3-(2-Fluorophenyl)-N7,N7-dimethylquinoline-2,7-diamine) |
| 2,7-Quinolinediamine, 3-(2-fluorophenyl)-N7,N7-dimethyl- |
| Arylquin 1 |
| MFCD28580129 |
| 3-(2-Fluorophenyl)-N7,N7-dimethyl-2,7-quinolinediamine |