GSK3008348
Modify Date: 2025-10-23 19:05:59
GSK3008348 structure
|
Common Name | GSK3008348 | ||
|---|---|---|---|---|
| CAS Number | 1629249-33-7 | Molecular Weight | 487.636 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 716.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C29H37N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 387.0±32.9 °C | |
Use of GSK3008348GSK3008348 is an Integrin alphaV inhibitor. |
| Name | GSK3008348 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 716.2±60.0 °C at 760 mmHg |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.636 |
| Flash Point | 387.0±32.9 °C |
| Exact Mass | 487.294739 |
| LogP | 3.57 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | GCZLVFRSWWTRPH-YSCHMLPRSA-N |
| SMILES | Cc1cc(C)n(-c2cccc(C(CC(=O)O)CN3CCC(CCc4ccc5c(n4)NCCC5)C3)c2)n1.Cl |
| Storage condition | 2-8℃ |
| 1-Pyrrolidinebutanoic acid, β-[3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-3-[2-(1,5,6,7-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-, (βS,3R)- |
| (3S)-3-[3-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl]-4-{(3R)-3-[2-(1,5,6,7-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-1-pyrrolidinyl}butanoic acid |