IDO-IN-4
Modify Date: 2025-09-04 00:52:09
IDO-IN-4 structure
|
Common Name | IDO-IN-4 | ||
|---|---|---|---|---|
| CAS Number | 1629125-65-0 | Molecular Weight | 437.574 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 532.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C26H35N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.9±30.1 °C | |
Use of IDO-IN-4IDO-IN-4 is an indoleamine 2,3-dioxygenase 1 (IDO-1) inhibitor, extracted from patent WO2014150677A1, Compound example 1 enantiomer 1. |
| Name | IDO-IN-4 |
|---|---|
| Synonym | More Synonyms |
| Description | IDO-IN-4 is an indoleamine 2,3-dioxygenase 1 (IDO-1) inhibitor, extracted from patent WO2014150677A1, Compound example 1 enantiomer 1. |
|---|---|
| Related Catalog | |
| Target |
IDO-1 |
| In Vitro | IDO-IN-4 (Compound example 1 enantiomer 1) is a IDO-1 inhibitor in human IDO1/HEK293 cells[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.6±50.0 °C at 760 mmHg |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.574 |
| Flash Point | 275.9±30.1 °C |
| Exact Mass | 437.267853 |
| LogP | 5.74 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | VZYCPKLOYXSKAB-FGZHOGPDSA-N |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C3CC3C(=O)O)ccc2N(CC(C)C)CC(C)C)cc1 |
| Storage condition | 2-8℃ |
| Cyclopropanecarboxylic acid, 2-[4-[bis(2-methylpropyl)amino]-3-[[[(4-methylphenyl)amino]carbonyl]amino]phenyl]-, (1R,2S)- |
| (1R,2S)-2-[4-(Diisobutylamino)-3-{[(4-methylphenyl)carbamoyl]amino}phenyl]cyclopropanecarboxylic acid |