Naphthalene,2,6-dimethyl-1,5-dinitro-
Modify Date: 2025-09-05 16:55:45
Naphthalene,2,6-dimethyl-1,5-dinitro- structure
|
Common Name | Naphthalene,2,6-dimethyl-1,5-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 16275-25-5 | Molecular Weight | 246.21900 | |
| Density | 1.369g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.7ºC | |
| Name | 2,6-dimethyl-para-phenylenediamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.21900 |
| Flash Point | 195.7ºC |
| Exact Mass | 246.06400 |
| PSA | 91.64000 |
| LogP | 4.31940 |
| Vapour Pressure | 2.7E-06mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | HNFYEKHUPOUFBE-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c([N+](=O)[O-])c(C)ccc2c1[N+](=O)[O-] |
|
~%
Naphthalene,2,6... CAS#:16275-25-5 |
| Literature: Vesely; Medvedeva Collection of Czechoslovak Chemical Communications, 1936 , vol. 8, p. 125,127 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,6-dimethyl-1,5-dinitro-naphthalene |
| 2,6-Dimethyl-1,5-dinitronaphthalin |
| 2,6-dimethyl-1,4-diaminobenzene |
| 2,6-dimethyl-p-phenylenediamine |
| 2,6-Dimethyl-p-phenylendiamin |
| 2,6-dimethyl-1,4-phenylenediamine |
| 1,5-Dinitro-2,6-dimethyl-naphthalin |
| 4-Amino-2,6-dimethylaniline |
| 1,4-diamino-2,6-dimethyl-benzene |