2-(triethoxysilyl)butyronitrile structure
|
Common Name | 2-(triethoxysilyl)butyronitrile | ||
|---|---|---|---|---|
| CAS Number | 1627-95-8 | Molecular Weight | 231.36400 | |
| Density | 0.955g/cm3 | Boiling Point | 244.8ºC at 760mmHg | |
| Molecular Formula | C10H21NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.9ºC | |
| Name | 2-triethoxysilylbutanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 0.955g/cm3 |
|---|---|
| Boiling Point | 244.8ºC at 760mmHg |
| Molecular Formula | C10H21NO3Si |
| Molecular Weight | 231.36400 |
| Flash Point | 101.9ºC |
| Exact Mass | 231.12900 |
| PSA | 51.48000 |
| LogP | 2.33858 |
| Vapour Pressure | 0.0297mmHg at 25°C |
| Index of Refraction | 1.427 |
| InChIKey | RDNFTJRPCZDKHN-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)C(C#N)CC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 216-619-6 |
| Butanenitrile,2-(triethoxysilyl) |
| 2-(Triethoxysilyl)butyronitrile |
| 2-(triethoxysilyl)butanenitrile |