N,N'-Diethyl-6-piperidino-1,3,5-triazine-2,4-diamine structure
|
Common Name | N,N'-Diethyl-6-piperidino-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 16268-60-3 | Molecular Weight | 250.34300 | |
| Density | 1.173g/cm3 | Boiling Point | 430.9ºC at 760 mmHg | |
| Molecular Formula | C12H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | 2-N,4-N-diethyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 430.9ºC at 760 mmHg |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.34300 |
| Flash Point | 214.4ºC |
| Exact Mass | 250.19100 |
| PSA | 72.43000 |
| LogP | 0.63430 |
| Vapour Pressure | 1.25E-07mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | BAMOQYHMXONIIV-UHFFFAOYSA-N |
| SMILES | CCNc1nc(NCC)nc(N2CCCCC2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N2,N4-diethyl-6-(piperidin-1-yl)-1,3,5-triazine-2,4-diamine |
| 2-Piperidino-4.6-bis-ethylamino-s-triazin |
| 2,4-Bis(ethylamino)-6-piperidino-s-triazine |
| N,N'-diethyl-6-(piperidin-1-yl)-1,3,5-triazine-2,4-diamine |
| s-Triazine,2,4-bis(ethylamino)-6-piperidino |