3-(3,5-difluorophenyl)pentanedioic acid structure
|
Common Name | 3-(3,5-difluorophenyl)pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 162549-35-1 | Molecular Weight | 244.19200 | |
| Density | 1.434g/cm3 | Boiling Point | 349.1ºC at 760mmHg | |
| Molecular Formula | C11H10F2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 3-(3,5-difluorophenyl)pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 349.1ºC at 760mmHg |
| Molecular Formula | C11H10F2O4 |
| Molecular Weight | 244.19200 |
| Flash Point | 165ºC |
| Exact Mass | 244.05500 |
| PSA | 74.60000 |
| LogP | 1.99780 |
| Vapour Pressure | 1.8E-05mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | QZZKCORFMJMYJP-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(CC(=O)O)c1cc(F)cc(F)c1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Pentanedioic acid,3-(3,5-difluorophenyl) |
| 3-(3,5-Difluorophenyl)glutaricacid |
| 3-(3,5-Difluoro-phenyl)-pentanedioic acid |