Pulsatilloside C
Modify Date: 2025-08-20 19:10:07
Pulsatilloside C structure
|
Common Name | Pulsatilloside C | ||
|---|---|---|---|---|
| CAS Number | 162341-28-8 | Molecular Weight | 943.122 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 999.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C48H78O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.1±27.8 °C | |
Use of Pulsatilloside CPulsatilloside C is a phenolic compound isolated from Pulsatilla koreana. Pulsatilloside C significantly inhibits adipocyte differentiation[1]. |
| Name | Pulsatilloside C |
|---|
| Description | Pulsatilloside C is a phenolic compound isolated from Pulsatilla koreana. Pulsatilloside C significantly inhibits adipocyte differentiation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 999.2±65.0 °C at 760 mmHg |
| Molecular Formula | C48H78O18 |
| Molecular Weight | 943.122 |
| Flash Point | 283.1±27.8 °C |
| Exact Mass | 942.518799 |
| LogP | 4.58 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | VNTZDFZAGFBUPV-HKINQWRBSA-N |
| SMILES | C=C(C)C1CCC2(C(=O)OC3OC(COC4OC(CO)C(OC5OC(C)C(O)C(O)C5O)C(O)C4O)C(O)C(O)C3O)CCC3(C)C(CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C12 |