Carbamic acid 1-phenoxymethyl-2-(2-propynyloxy)ethyl ester
Modify Date: 2025-09-30 11:31:17
Carbamic acid 1-phenoxymethyl-2-(2-propynyloxy)ethyl ester structure
|
Common Name | Carbamic acid 1-phenoxymethyl-2-(2-propynyloxy)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 16221-63-9 | Molecular Weight | 249.26200 | |
| Density | 1.186g/cm3 | Boiling Point | 433.7ºC at 760mmHg | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
| Name | (1-phenoxy-3-prop-2-ynoxypropan-2-yl) carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 433.7ºC at 760mmHg |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26200 |
| Flash Point | 211.7ºC |
| Exact Mass | 249.10000 |
| PSA | 71.77000 |
| LogP | 1.69290 |
| Vapour Pressure | 1E-07mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | OQFCXAPFTKYGFA-UHFFFAOYSA-N |
| SMILES | C#CCOCC(COc1ccccc1)OC(N)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Phenyl-3-(2-propynyloxy)-2-propanol carbamate |
| 2-Propanol,1-phenoxy-3-(2-propynyloxy)-,carbamate |
| 1-Propargyloxy-3-phenoxy-2-carbamoyloxy-propan |
| 1-Propargyloxy-3-phenoxy-2-carbamyloxy-propan |
| 1-Propargyl-2-carbamoyl glycerol 3-phenyl ether |