Talastine
Modify Date: 2025-08-25 13:42:08
Talastine structure
|
Common Name | Talastine | ||
|---|---|---|---|---|
| CAS Number | 16188-61-7 | Molecular Weight | 307.39000 | |
| Density | 1.11g/cm3 | Boiling Point | 466.8ºC at 760mmHg | |
| Molecular Formula | C19H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
| Name | 4-benzyl-2-[2-(dimethylamino)ethyl]phthalazin-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 466.8ºC at 760mmHg |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.39000 |
| Flash Point | 236.1ºC |
| Exact Mass | 307.16800 |
| PSA | 38.13000 |
| LogP | 2.54890 |
| Vapour Pressure | 6.85E-09mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | LCAAMXMULMCKLJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCn1nc(Cc2ccccc2)c2ccccc2c1=O |
| HS Code | 2933990090 |
|---|
|
~%
Talastine CAS#:16188-61-7 |
| Literature: VEB Deutsches Hydrierwerk Patent: DE1046625 , 1957 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Benzyl-2-(2-dimethylamino-ethyl)-1-oxo-1.2-dihydro-phthalazin |
| Talastinum |
| Talastina |
| Talastine |
| 4-Benzyl-2-(2-dimethylamino-aethyl)-2H-phthalazin-1-on |
| Talastine (INN) |
| Talastinum [INN-Latin] |
| 4-benzyl-2-(2-dimethylamino-ethyl)-2H-phthalazin-1-one |
| Talastina [INN-Spanish] |