N-benzyl-4-[4-(2,4-difluorophenyl)phenyl]-2-methyl-4-oxobutanamide structure
|
Common Name | N-benzyl-4-[4-(2,4-difluorophenyl)phenyl]-2-methyl-4-oxobutanamide | ||
|---|---|---|---|---|
| CAS Number | 161692-86-0 | Molecular Weight | 393.42600 | |
| Density | 1.2g/cm3 | Boiling Point | 587.7ºC at 760 mmHg | |
| Molecular Formula | C24H21F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.2ºC | |
| Name | N-benzyl-4-[4-(2,4-difluorophenyl)phenyl]-2-methyl-4-oxobutanamide |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 587.7ºC at 760 mmHg |
| Molecular Formula | C24H21F2NO2 |
| Molecular Weight | 393.42600 |
| Flash Point | 309.2ºC |
| Exact Mass | 393.15400 |
| PSA | 49.66000 |
| LogP | 5.99740 |
| Vapour Pressure | 8.6E-14mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | KSLAABIUMTXJJJ-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)c1ccc(-c2ccc(F)cc2F)cc1)C(=O)NCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |