1-(2-Iodoethyl)-2-methyl-4-nitro-1H-imidazole structure
|
Common Name | 1-(2-Iodoethyl)-2-methyl-4-nitro-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 16156-96-0 | Molecular Weight | 281.05100 | |
| Density | 2.03g/cm3 | Boiling Point | 395.1ºC at 760mmHg | |
| Molecular Formula | C6H8IN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | 1-(2-iodoethyl)-2-methyl-4-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.03g/cm3 |
|---|---|
| Boiling Point | 395.1ºC at 760mmHg |
| Molecular Formula | C6H8IN3O2 |
| Molecular Weight | 281.05100 |
| Flash Point | 192.8ºC |
| Exact Mass | 280.96600 |
| PSA | 63.64000 |
| LogP | 2.05790 |
| Vapour Pressure | 4.29E-06mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | WIQJRGFUJZSBKC-UHFFFAOYSA-N |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCI |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Imidazole,1-(2-iodoethyl)-2-methyl-4-nitro |
| 1-(2-iodo-ethyl)-2-methyl-4-nitro-1H-imidazole |