Methyl(phenoxyacetyl)carbamic acid m-sec-butylphenyl ester
Modify Date: 2025-08-26 09:18:16
Methyl(phenoxyacetyl)carbamic acid m-sec-butylphenyl ester structure
|
Common Name | Methyl(phenoxyacetyl)carbamic acid m-sec-butylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 16156-66-4 | Molecular Weight | 341.40100 | |
| Density | 1.14g/cm3 | Boiling Point | 454.5ºC at 760 mmHg | |
| Molecular Formula | C20H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | (3-butan-2-ylphenyl) N-methyl-N-(2-phenoxyacetyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 454.5ºC at 760 mmHg |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40100 |
| Flash Point | 228.7ºC |
| Exact Mass | 341.16300 |
| PSA | 55.84000 |
| LogP | 4.23630 |
| Vapour Pressure | 1.89E-08mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | KJXDJOLKOLXZFF-UHFFFAOYSA-N |
| SMILES | CCC(C)c1cccc(OC(=O)N(C)C(=O)COc2ccccc2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| CARBAMIC ACID,METHYL(PHENOXYACETYL)-,m-sec-BUTYLPHENYL ESTER |
| 2-(1-Methylpropyl)phenyl methyl(phenoxyacetyl)carbamate |
| Carbamic acid,methyl(phenoxyacetyl)-,2-(1-methylpropyl)phenyl ester |
| ENT 27,352 |