BOC-BETA-(2-QUINOLYL)-ALA-OH
Modify Date: 2025-08-23 17:10:09
BOC-BETA-(2-QUINOLYL)-ALA-OH structure
|
Common Name | BOC-BETA-(2-QUINOLYL)-ALA-OH | ||
|---|---|---|---|---|
| CAS Number | 161453-37-8 | Molecular Weight | 316.35200 | |
| Density | 1.235±0.06 g/cm3(Predicted) | Boiling Point | 505.6±45.0 °C(Predicted) | |
| Molecular Formula | C17H20N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | Boc-β-2-quinolyl)-Ala-OH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 505.6±45.0 °C(Predicted) |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.35200 |
| Exact Mass | 316.14200 |
| PSA | 88.52000 |
| LogP | 3.14610 |
| InChIKey | IKKVPSHCOQHAMU-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc2ccccc2n1)C(=O)O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2S)-3-isoquinolin-3-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |