Butanoic acid,4-[(3-methoxyphenyl)amino]-4-oxo- structure
|
Common Name | Butanoic acid,4-[(3-methoxyphenyl)amino]-4-oxo- | ||
|---|---|---|---|---|
| CAS Number | 16141-44-9 | Molecular Weight | 223.22500 | |
| Density | 1.281g/cm3 | Boiling Point | 485.1ºC at 760mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.2ºC | |
| Name | 4-(3-methoxyanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 485.1ºC at 760mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 247.2ºC |
| Exact Mass | 223.08400 |
| PSA | 75.63000 |
| LogP | 1.57150 |
| Vapour Pressure | 3.18E-10mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | DLSAAWQLSTXCNZ-UHFFFAOYSA-N |
| SMILES | COc1cccc(NC(=O)CCC(=O)O)c1 |
| HS Code | 2922509090 |
|---|
|
~%
Butanoic acid,4... CAS#:16141-44-9 |
| Literature: Journal of the Indian Chemical Society, , vol. 69, # 10 p. 683 - 684 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| f0722-3708 |