2,7-Dimethoxy-1,4,5,8-tetrahydronaphthalene structure
|
Common Name | 2,7-Dimethoxy-1,4,5,8-tetrahydronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 1614-82-0 | Molecular Weight | 192.254 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 341.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O2 | Melting Point | 64.0 to 68.0 deg-C | |
| MSDS | N/A | Flash Point | 145.2±27.4 °C | |
| Name | 2,7-Dimethoxy-1,4,5,8-tetrahydronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 341.0±42.0 °C at 760 mmHg |
| Melting Point | 64.0 to 68.0 deg-C |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.254 |
| Flash Point | 145.2±27.4 °C |
| Exact Mass | 192.115036 |
| PSA | 18.46000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | PWPPYWWWEVISEX-UHFFFAOYSA-N |
| SMILES | COC1=CCC2=C(C1)CC(OC)=CC2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,7-Dimethoxy-1,4,5,8-tetrahydronaphthalene |
| Naphthalene, 1,4,5,8-tetrahydro-2,7-dimethoxy- |
| 1,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene |