(S)-N-Butyl-1-[(2-hydroxybenzyl)-L-valyl]pyrrolidine-2-carboxamide
Modify Date: 2025-10-19 17:01:06
![(S)-N-Butyl-1-[(2-hydroxybenzyl)-L-valyl]pyrrolidine-2-carboxamide Structure](https://image.chemsrc.com/caspic/341/1613249-60-7.png)
(S)-N-Butyl-1-[(2-hydroxybenzyl)-L-valyl]pyrrolidine-2-carboxamide structure
|
Common Name | (S)-N-Butyl-1-[(2-hydroxybenzyl)-L-valyl]pyrrolidine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1613249-60-7 | Molecular Weight | 375.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H33N3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (S)-N-Butyl-1-[(2-hydroxybenzyl)-L-valyl]pyrrolidine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H33N3O3 |
|---|---|
| Molecular Weight | 375.51 |
| InChIKey | YETNAJXRRQTUPV-HKUYNNGSSA-N |
| SMILES | CCCCNC(=O)C1CCCN1C(=O)C(NCc1ccccc1O)C(C)C |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |
|
A dual-catalysis approach to enantioselective [2 + 2] photocycloadditions using visible light.
Science 344(6182) , 392-6, (2014) In contrast to the wealth of catalytic systems that are available to control the stereochemistry of thermally promoted cycloadditions, few similarly effective methods exist for the stereocontrol of ph... |
| Yoon Syn-[2+2]-Photocycloaddition Ligand |