ATTO 425 azide structure
|
Common Name | ATTO 425 azide | ||
|---|---|---|---|---|
| CAS Number | 1609584-73-7 | Molecular Weight | 601.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H43N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ATTO 425 azideATTO 425 Azide is an azide derivative of ATTO 425, the maximum excitation and emission wavelength: 439/489 nm. |
| Name | ATTO 425 azide |
|---|
| Description | ATTO 425 Azide is an azide derivative of ATTO 425, the maximum excitation and emission wavelength: 439/489 nm. |
|---|---|
| Related Catalog |
| Molecular Formula | C30H43N5O8 |
|---|---|
| Molecular Weight | 601.69 |
| InChIKey | RSOCGOAHHWBJFE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc3c(cc2oc1=O)N(CCCC(=O)NCCOCCOCCOCCN=[N+]=[N-])C(C)(C)CC3C |