Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-5-thiazolecarboxylate structure
|
Common Name | Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-5-thiazolecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 160844-75-7 | Molecular Weight | 344.428 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 497.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H20N2O3S | Melting Point | 176 °C | |
| MSDS | N/A | Flash Point | 254.5±31.5 °C | |
| Name | Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.1±55.0 °C at 760 mmHg |
| Melting Point | 176 °C |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.428 |
| Flash Point | 254.5±31.5 °C |
| Exact Mass | 344.119476 |
| PSA | 100.45000 |
| LogP | 5.70 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | OGAZOYHQFBSRMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(-c2ccc(OCC(C)C)c(C#N)c2)nc1C |
| HS Code | 2942000000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-5-thiazolecarboxylate |
| 2-(3-Cyano-4-isobutoxy-phenyl)-4-methyl-thiazole-5-carboxylic acid ethyl ester |
| Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| 5-Thiazolecarboxylic acid, 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-, ethyl ester |
| Febuxostat Impurity 13 |