4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one
Modify Date: 2025-11-02 11:06:34
4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one structure
|
Common Name | 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one | ||
|---|---|---|---|---|
| CAS Number | 160661-62-1 | Molecular Weight | 344.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21N2O3P |
|---|---|
| Molecular Weight | 344.3 |
| InChIKey | FRDPTRCZEMXIAQ-UHFFFAOYSA-N |
| SMILES | COP1(=O)C(Cc2ccccc2)NC(=O)NC1Cc1ccccc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory activity was evaluated against HIV-1 protease; Not Active
Source: ChEMBL
Target: Pol polyprotein
External Id: CHEMBL687722
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one? |
| A: Molecular formula of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one is C18H21N2O3P. |
| Q: What is the InChIKey of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one? |
| A: InChIKey of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one is FRDPTRCZEMXIAQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one? |
| A: Molecular weight of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one is 344.3. |
| Q: What is the English name of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one? |
| A: The English name of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one is 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one. |
| Q: What is the CAS number of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one? |
| A: CAS number of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one is 160661-62-1. |
| Q: What is the Chinese name of 160661-62-1? |
| A: Chinese name of 160661-62-1 is 160661-62-1. |
| Q: What is the SMILES notation of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one? |
| A: SMILES notation of 4,6-Dibenzyl-5-methoxy-5-oxo-1,3,5lambda5-diazaphosphinan-2-one is COP1(=O)C(Cc2ccccc2)NC(=O)NC1Cc1ccccc1. |