Benzoic acid,2,3,4,5,6-pentafluoro-, 2-(2,3,4,5,6-pentafluorobenzoyl)hydrazide structure
|
Common Name | Benzoic acid,2,3,4,5,6-pentafluoro-, 2-(2,3,4,5,6-pentafluorobenzoyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 16065-70-6 | Molecular Weight | 420.16200 | |
| Density | 1.749g/cm3 | Boiling Point | 538.9ºC at 760mmHg | |
| Molecular Formula | C14H2F10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.7ºC | |
| Name | 2,3,4,5,6-pentafluoro-N'-(2,3,4,5,6-pentafluorobenzoyl)benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.749g/cm3 |
|---|---|
| Boiling Point | 538.9ºC at 760mmHg |
| Molecular Formula | C14H2F10N2O2 |
| Molecular Weight | 420.16200 |
| Flash Point | 279.7ºC |
| Exact Mass | 419.99600 |
| PSA | 58.20000 |
| LogP | 3.93420 |
| Vapour Pressure | 1.1E-11mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | UKJJCJYJYWBWKG-UHFFFAOYSA-N |
| SMILES | O=C(NNC(=O)c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
|
~83%
Benzoic acid,2,... CAS#:16065-70-6 |
| Literature: Zheng, Xiumian; Li, Zhong; Wang, Yanli; Chen, Weidong; Huang, Qingchun; Liu, Chuanxiang; Song, Gonghua Journal of Fluorine Chemistry, 2003 , vol. 123, # 2 p. 163 - 169 |
|
~67%
Benzoic acid,2,... CAS#:16065-70-6 |
| Literature: Gmelin Handbook: F: PerFHalOrg.8, 3, page 55 - 151 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N.N'-Bis-pentafluor-benzoyl-hydrazin |
| N'-pentafluorobenzoyl-pentafluorobenzohydrazide |
| N,N'-bis-pentafluorobenzoyl-hydrazine |
| N'-Pentafluorbenzoyl-pentafluorbenzohydrazid |