N-[9-[(2R)-2-hydroxypropyl]purin-6-yl]benzamide structure
|
Common Name | N-[9-[(2R)-2-hydroxypropyl]purin-6-yl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 160616-03-5 | Molecular Weight | 297.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[9-[(2R)-2-hydroxypropyl]purin-6-yl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15N5O2 |
|---|---|
| Molecular Weight | 297.31200 |
| Exact Mass | 297.12300 |
| PSA | 96.42000 |
| LogP | 1.84340 |
| InChIKey | DZTLHJVINSWGSG-SNVBAGLBSA-N |
| SMILES | CC(O)Cn1cnc2c(NC(=O)c3ccccc3)ncnc21 |
|
~%
N-[9-[(2R)-2-hy... CAS#:160616-03-5 |
| Literature: Holy, Antonin; Masojidkova, Milena Collection of Czechoslovak Chemical Communications, 1995 , vol. 60, # 7 p. 1196 - 1212 |
|
~%
N-[9-[(2R)-2-hy... CAS#:160616-03-5 |
| Literature: Holy, Antonin; Masojidkova, Milena Collection of Czechoslovak Chemical Communications, 1995 , vol. 60, # 7 p. 1196 - 1212 |
| Benzamide,N-[9-[(2R)-2-hydroxypropyl]-9H-purin-6-yl] |
| (R)-9-(2-hydroxypropyl)-N6-benzoyladenine |