Naphtho[2,3-f]quinoxaline-7,12-dione, 6-[(2-aminoethyl)amino]-1,2,3,4-tetrahydro- structure
|
Common Name | Naphtho[2,3-f]quinoxaline-7,12-dione, 6-[(2-aminoethyl)amino]-1,2,3,4-tetrahydro- | ||
|---|---|---|---|---|
| CAS Number | 16013-92-6 | Molecular Weight | 322.36100 | |
| Density | 1.356g/cm3 | Boiling Point | 651.2ºC at 760 mmHg | |
| Molecular Formula | C18H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-aminoethylamino)-1,2,3,4-tetrahydronaphtho[3,2-f]quinoxaline-7,12-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.356g/cm3 |
|---|---|
| Boiling Point | 651.2ºC at 760 mmHg |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.36100 |
| Exact Mass | 322.14300 |
| PSA | 96.25000 |
| LogP | 2.71930 |
| Vapour Pressure | 7.67E-17mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | IGNNTKYSHZMDMH-UHFFFAOYSA-N |
| SMILES | NCCNc1cc2c(c3c(O)c4ccccc4c(O)c13)=NCCN=2 |
|
~55%
Naphtho[2,3-f]q... CAS#:16013-92-6 |
| Literature: Chang, Pong; Chen, Chia-Fu Journal of Heterocyclic Chemistry, 1996 , vol. 33, # 2 p. 367 - 371 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-(2-aminoethylamino)-1,2,3,4-tetrahydronaphtho<2,3-f>quinoxaline-7,12-dione |