Xyloxemine
Modify Date: 2025-10-10 18:40:51
Xyloxemine structure
|
Common Name | Xyloxemine | ||
|---|---|---|---|---|
| CAS Number | 1600-19-7 | Molecular Weight | 355.51400 | |
| Density | 1.005g/cm3 | Boiling Point | 458.8ºC at 760mmHg | |
| Molecular Formula | C23H33NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 2-[2-[bis(2,6-dimethylphenyl)methoxy]ethoxy]-N,N-dimethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 458.8ºC at 760mmHg |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.51400 |
| Flash Point | 175.8ºC |
| Exact Mass | 355.25100 |
| PSA | 21.70000 |
| LogP | 4.60440 |
| Vapour Pressure | 1.33E-08mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | KLOZENAJUCRQKD-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1C(OCCOCCN(C)C)c1c(C)cccc1C |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Xyloxeminum |
| UNII-L95KV83PV9 |
| Xiloxemina |
| Xyloxemine |