Deruxtecan analog
Modify Date: 2025-08-20 16:36:16
Deruxtecan analog structure
|
Common Name | Deruxtecan analog | ||
|---|---|---|---|---|
| CAS Number | 1599440-13-7 | Molecular Weight | 1034.05 | |
| Density | 1.48±0.1 g/cm3 | Boiling Point | 1491.1±65.0 °C | |
| Molecular Formula | C52H56FN9O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Deruxtecan analogDeruxtecan analog is a drug-linker conjugate for antibody-drug conjugate (ADC) extracted from patent WO2017002776A1, compound 1. |
| Name | Deruxtecan analog |
|---|
| Description | Deruxtecan analog is a drug-linker conjugate for antibody-drug conjugate (ADC) extracted from patent WO2017002776A1, compound 1. |
|---|---|
| Related Catalog | |
| Target |
Drug-linker conjugates for ADC[1] |
| In Vitro | Antibody-drug conjugates deliver anticancer agents selectively and efficiently to tumor tissue and have significant antitumor efficacy with a wide therapeutic window[2]. |
| References |
| Density | 1.48±0.1 g/cm3 |
|---|---|
| Boiling Point | 1491.1±65.0 °C |
| Molecular Formula | C52H56FN9O13 |
| Molecular Weight | 1034.05 |
| InChIKey | WXNSCLIZKHLNSG-MCZRLCSDSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(NC(=O)COCNC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O)CC3 |