Fmoc-Gly-NH-CH2-O-CH2COOH structure
|
Common Name | Fmoc-Gly-NH-CH2-O-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1599440-08-0 | Molecular Weight | 384.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Gly-NH-CH2-O-CH2COOHFmoc-Gly-NH-CH2-O-CH2COOH is an ADC linker. Fmoc-Gly-NH-CH2-O-CH2COOH can be used for synthesis of ADCs[1]. |
| Name | 1-(9H-Fluoren-9-yl)-3,6-dioxo-2,9-dioxa-4,7-diazaundecan-11-oic acid |
|---|
| Description | Fmoc-Gly-NH-CH2-O-CH2COOH is an ADC linker. Fmoc-Gly-NH-CH2-O-CH2COOH can be used for synthesis of ADCs[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H20N2O6 |
|---|---|
| Molecular Weight | 384.38 |
| InChIKey | LIBCNUNKCWYZAX-UHFFFAOYSA-N |
| SMILES | O=C(O)COCNC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |