2-Methoxy-6-nitrophenol structure
|
Common Name | 2-Methoxy-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 15969-08-1 | Molecular Weight | 169.135 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 260.3±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.2±21.8 °C | |
| Name | 2-methoxy-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 260.3±20.0 °C at 760 mmHg |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.135 |
| Flash Point | 111.2±21.8 °C |
| Exact Mass | 169.037506 |
| PSA | 75.28000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | WRXFJKBQZVRPHI-UHFFFAOYSA-N |
| SMILES | COc1cccc([N+](=O)[O-])c1O |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Nitro-brenzcatechin-1-methylaether |
| 3-Nitro-guajacol |
| 6-methoxy-2-nitrophenol |
| 2-nitro-6-methoxyphenol |
| 6-nitroguaiacol |
| 2-Methoxy-6-nitrophenol |
| Phenol, 2-methoxy-6-nitro- |
| 2-Methoxy-6-nitro-phenol |