2-fluoro-2,2-dinitroethyl 4-fluoro-4,4-dinitrobutyrate
Modify Date: 2025-08-25 11:43:36
2-fluoro-2,2-dinitroethyl 4-fluoro-4,4-dinitrobutyrate structure
|
Common Name | 2-fluoro-2,2-dinitroethyl 4-fluoro-4,4-dinitrobutyrate | ||
|---|---|---|---|---|
| CAS Number | 15957-54-7 | Molecular Weight | 332.12900 | |
| Density | 1.719g/cm3 | Boiling Point | 349.8ºC at 760mmHg | |
| Molecular Formula | C6H6F2N4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.4ºC | |
| Name | (2-fluoro-2,2-dinitroethyl) 4-fluoro-4,4-dinitrobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.719g/cm3 |
|---|---|
| Boiling Point | 349.8ºC at 760mmHg |
| Molecular Formula | C6H6F2N4O10 |
| Molecular Weight | 332.12900 |
| Flash Point | 165.4ºC |
| Exact Mass | 332.00500 |
| PSA | 209.58000 |
| LogP | 1.75600 |
| Vapour Pressure | 4.58E-05mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | RSJWIXWBPOAQET-UHFFFAOYSA-N |
| SMILES | O=C(CCC(F)([N+](=O)[O-])[N+](=O)[O-])OCC(F)([N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2915900090 |
|---|
|
~%
2-fluoro-2,2-di... CAS#:15957-54-7 |
| Literature: Adolph,H.G.; Kamlet,M.J. Journal of Organic Chemistry, 1969 , vol. 34, p. 45 - 50 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| EINECS 240-086-9 |
| 4-Fluor-4,4-dinitrobuttersaeure-(2-fluor-2,2-dinitroethyl)ester |
| Ethanol,2-fluoro-2,2-dinitro-,4-fluoro-4,4-dinitrobutyrate |
| Butanoic acid,4-fluoro-4,4-dinitro-,2-fluoro-2,2-dinitroethyl ester |
| Butyricacid,4-fluoro-4,4-dinitro-,2-fluoro-2,2-dinitroethyl ester (8CI) |
| Ethanol,2-fluoro-2,2-dinitro-,4-fluoro-4,4-dinitrobutyrate (ester) |
| 2-fluoro-2,2-dinitroethyl 4-fluoro-4,4-dinitrobutyrate |