1,7-Dichloro-9,10-anthraquinone structure
|
Common Name | 1,7-Dichloro-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 1594-69-0 | Molecular Weight | 277.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H6Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,7-dichloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H6Cl2O2 |
|---|---|
| Molecular Weight | 277.10200 |
| Exact Mass | 275.97400 |
| PSA | 34.14000 |
| LogP | 3.76880 |
| InChIKey | ASMKLYHDMPMGHC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)c2c(Cl)cccc21 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,7-dichloroanthraquinone |
| 1,7-Dichlor-anthrachinon |
| 1,7-Dichloro-9,10-anthraquinone |
| 1,7-Dichloranthrachinon-(9,10) |
| 1,7-dichloro-9,10-anthracenedione |
| 9,10-Anthracenedione,1,7-dichloro |