1,2,3,4,5,6-Hexahydro-9-methylazepino[4,5-b]indole structure
|
Common Name | 1,2,3,4,5,6-Hexahydro-9-methylazepino[4,5-b]indole | ||
|---|---|---|---|---|
| CAS Number | 15918-89-5 | Molecular Weight | 200.28000 | |
| Density | 1.12g/cm3 | Boiling Point | 383.7ºC at 760mmHg | |
| Molecular Formula | C13H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | 9-methyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 383.7ºC at 760mmHg |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28000 |
| Flash Point | 185.9ºC |
| Exact Mass | 200.13100 |
| PSA | 27.82000 |
| LogP | 2.49330 |
| Vapour Pressure | 4.31E-06mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | FVLVZXBWCQAPAT-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCNCC3 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,3,4,5,6-Hexahydro-9-methyl-azepino(4,5-b)indole |
| 9-Methyl-1,2,3,4,5,6-hexahydro-azepino<4,5-b>indol |
| 9-methyl-1,2,3,4,5,6-hexahydro-azepino[4,5-b]indole |
| AZEPINO(4,5-b)INDOLE,1,2,3,4,5,6-HEXAHYDRO-9-METHYL |