1,5-Di(trimethylsilyl)pentane
Modify Date: 2025-10-23 07:27:40
1,5-Di(trimethylsilyl)pentane structure
|
Common Name | 1,5-Di(trimethylsilyl)pentane | ||
|---|---|---|---|---|
| CAS Number | 15895-92-8 | Molecular Weight | 216.51100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H28Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(5-trimethylsilylpentyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H28Si2 |
|---|---|
| Molecular Weight | 216.51100 |
| Exact Mass | 216.17300 |
| LogP | 4.83310 |
| InChIKey | CARCLKGQWADKFV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCCCC[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,5-Bis-trimethylsilyl-pentan |
| hexa-Si-methyl-Si,Si'-pentanediyl-bis-silane |
| Hexa-Si-methyl-Si,Si'-pentandiyl-bis-silan |
| Bis-trimethylsilyl-pentamethylen |