2-hydroxy-3-methyl-2-phenylbutanoic acid
Modify Date: 2025-10-23 12:02:57
2-hydroxy-3-methyl-2-phenylbutanoic acid structure
|
Common Name | 2-hydroxy-3-methyl-2-phenylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 15879-60-4 | Molecular Weight | 194.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-3-methyl-2-phenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14O3 |
|---|---|
| Molecular Weight | 194.22700 |
| Exact Mass | 194.09400 |
| PSA | 57.53000 |
| LogP | 1.61480 |
| InChIKey | KWPNNDWNSLBFPU-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)(C(=O)O)c1ccccc1 |
| HS Code | 2918199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:611-70-1| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| alpha-isopropyl-mandelic acid |
| 2-Hydroxy-2-phenylisovaleriansaeure |
| α-Phenyl-α-isopropylglycolsaeure |
| 2-hydroxy-3-methyl-2-phenyl-butyric acid |
| 2-Hydroxy-3-methyl-2-phenyl-buttersaeure |