Dicyclohexylphosphinyl Chloride structure
|
Common Name | Dicyclohexylphosphinyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 15873-72-0 | Molecular Weight | 248.72900 | |
| Density | 1.09g/cm3 | Boiling Point | 395ºC at 760 mmHg | |
| Molecular Formula | C12H22ClOP | Melting Point | 109ºC | |
| MSDS | N/A | Flash Point | 192.7ºC | |
| Name | Dicyclohexylphosphinyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 395ºC at 760 mmHg |
| Melting Point | 109ºC |
| Molecular Formula | C12H22ClOP |
| Molecular Weight | 248.72900 |
| Flash Point | 192.7ºC |
| Exact Mass | 248.11000 |
| PSA | 26.88000 |
| LogP | 5.16870 |
| Vapour Pressure | 4.32E-06mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | HKYSIUYOULVHTO-UHFFFAOYSA-N |
| SMILES | O=P(Cl)(C1CCCCC1)C1CCCCC1 |
| Storage condition | Refrigerator |
| RIDADR | 1759 |
|---|---|
| Packaging Group | III |
| HS Code | 2903890090 |
|
~%
Dicyclohexylpho... CAS#:15873-72-0 |
| Literature: Safiulina, Alfiya M.; Goryunov, Evgenii I.; Letyushov, Aleksandr A.; Goryunova, Irina B.; Smirnova, Sof'ya A.; Ginzburg, Allan G.; Tananaev, Ivan G.; Nifant'ev, Edward E.; Myasoedov, Boris F. Mendeleev Communications, 2009 , vol. 19, # 5 p. 263 - 265 |
|
~%
Dicyclohexylpho... CAS#:15873-72-0 |
| Literature: Mueller,E.; Padeken,H.G. Chemische Berichte, 1967 , vol. 100, p. 521 - 532 |
|
~%
Dicyclohexylpho... CAS#:15873-72-0 |
| Literature: Issleib; Brack Zeitschrift fuer Anorganische und Allgemeine Chemie, 1954 , vol. 277, p. 258,267 |
|
~%
Dicyclohexylpho... CAS#:15873-72-0 |
| Literature: Mueller,E.; Padeken,H.G. Chemische Berichte, 1967 , vol. 100, p. 521 - 532 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Chlorodicyclohexylphosphine oxide |
| dicyclohexylphosphinic chloride |
| DICYCLOHEXYLPHOSPHINYL CHLORIDE |
| dicyclohexylphosphoryl chloride |
| dicyclohexylphosphinoyl chloride |