Diheptyl Succinate structure
|
Common Name | Diheptyl Succinate | ||
|---|---|---|---|---|
| CAS Number | 15872-89-6 | Molecular Weight | 314.46000 | |
| Density | 0.945g/cm3 | Boiling Point | 351.3ºC at 760mmHg | |
| Molecular Formula | C18H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.5ºC | |
| Name | diheptyl butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.945g/cm3 |
|---|---|
| Boiling Point | 351.3ºC at 760mmHg |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.46000 |
| Flash Point | 157.5ºC |
| Exact Mass | 314.24600 |
| PSA | 52.60000 |
| LogP | 4.79380 |
| Vapour Pressure | 4.14E-05mmHg at 25°C |
| Index of Refraction | 1.447 |
| InChIKey | PBZAGXRVDLNBCJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC(=O)CCC(=O)OCCCCCCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| succinic acid diheptyl ester |
| Diheptyl succinate |
| Butanedioic acid,1,4-diheptyl ester |
| Bernsteinsaeure-diheptylester |
| EINECS 239-996-9 |
| di-n-heptyl succinate |