Phosphoric acid 1-methyl-2-piperidinoethyldiethyl ester
Modify Date: 2025-08-25 16:23:10
Phosphoric acid 1-methyl-2-piperidinoethyldiethyl ester structure
|
Common Name | Phosphoric acid 1-methyl-2-piperidinoethyldiethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15870-40-3 | Molecular Weight | 279.31300 | |
| Density | 1.069g/cm3 | Boiling Point | 345.8ºC at 760mmHg | |
| Molecular Formula | C12H26NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | diethyl 1-piperidin-1-ylpropan-2-yl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.069g/cm3 |
|---|---|
| Boiling Point | 345.8ºC at 760mmHg |
| Molecular Formula | C12H26NO4P |
| Molecular Weight | 279.31300 |
| Flash Point | 163ºC |
| Exact Mass | 279.16000 |
| PSA | 57.81000 |
| LogP | 2.99640 |
| Vapour Pressure | 5.99E-05mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | QOUGNHXZJRWYJO-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)OC(C)CN1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| DS-25 |
| Phosphoric acid,diethyl ester,ester with 1-methyl-2-piperidinoethanol |