Dichlorodinitromethane
Modify Date: 2025-09-11 17:56:38
Dichlorodinitromethane structure
|
Common Name | Dichlorodinitromethane | ||
|---|---|---|---|---|
| CAS Number | 1587-41-3 | Molecular Weight | 174.92800 | |
| Density | 1.872g/cm3 | Boiling Point | 121.5ºC at 760 mmHg | |
| Molecular Formula | CCl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 23.6ºC | |
| Name | dichloro(dinitro)methane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.872g/cm3 |
|---|---|
| Boiling Point | 121.5ºC at 760 mmHg |
| Molecular Formula | CCl2N2O4 |
| Molecular Weight | 174.92800 |
| Flash Point | 23.6ºC |
| Exact Mass | 173.92400 |
| PSA | 91.64000 |
| LogP | 1.67510 |
| Vapour Pressure | 14.5mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | VLWDJCZBZPKOGX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(Cl)(Cl)[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Dichlordinitronethan |
| Dichlordinitromethan |
| Dichlorodinitromethan |
| METHANE,DICHLORODINITRO |
| dichloro-dinitro-methane |
| Dichlordinitrokohlenstoff |