1-isothiocyanato-4-methylsulfonylbenzene
Modify Date: 2025-10-27 21:15:59
1-isothiocyanato-4-methylsulfonylbenzene structure
|
Common Name | 1-isothiocyanato-4-methylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 15863-56-6 | Molecular Weight | 213.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-isothiocyanato-4-methylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7NO2S2 |
|---|---|
| Molecular Weight | 213.27700 |
| Exact Mass | 212.99200 |
| PSA | 86.97000 |
| LogP | 2.90520 |
| InChIKey | VSEGGIPVCHEXNW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(N=C=S)cc1 |
|
~86%
1-isothiocyanat... CAS#:15863-56-6 |
| Literature: Chen, Li; Chu, Xin-Jie; Lovey, Allen John; Zhao, Chunlin Patent: US2006/14958 A1, 2006 ; Location in patent: Page/Page column 19 ; US 20060014958 A1 |
|
~%
1-isothiocyanat... CAS#:15863-56-6 |
| Literature: Doub et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 2205,2210 |
| 4-mesylphenyl-isothiocyanate |
| 4-methanesulfonyl-phenyl isothiocyanate |
| 1-isothiocyanato-4-(methylsulfonyl)benzene |
| Isothiocyanato-4-methanesulfonylbenzene |
| 1-isothiocyanato-4-methanesulfonylbenzene |
| 4-methylsulfonylphenyl isothiocyanate |
| 4-methylsulfonyl isothiocyanate |
| 4-Methansulfonyl-phenylisothiocyanat |
| Benzene,1-isothiocyanato-4-(methylsulfonyl) |