(2,3,4,5,6-pentafluorophenyl) 2-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]acetate structure
|
Common Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]acetate | ||
|---|---|---|---|---|
| CAS Number | 158573-58-1 | Molecular Weight | 466.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H4F10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H4F10O5 |
|---|---|
| Molecular Weight | 466.18400 |
| Exact Mass | 465.99000 |
| PSA | 61.83000 |
| LogP | 3.60520 |
| InChIKey | VNIBHSPJYBFDMX-UHFFFAOYSA-N |
| SMILES | O=C(COCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)Oc1c(F)c(F)c(F)c(F)c1F |
|
~84%
(2,3,4,5,6-pent... CAS#:158573-58-1 |
| Literature: Van Oijen; Huck; Kruijtzer; Erkelens; Van Boom; Liskamp Journal of Organic Chemistry, 1994 , vol. 59, # 9 p. 2399 - 2408 |
|
~%
(2,3,4,5,6-pent... CAS#:158573-58-1 |
| Literature: Van Oijen; Huck; Kruijtzer; Erkelens; Van Boom; Liskamp Journal of Organic Chemistry, 1994 , vol. 59, # 9 p. 2399 - 2408 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| DIG(Pfp)2 |
| oxydiacetic acid pentafluorophenyl ester |
| AmbotzPEG1985 |