Ethanone, 1-(1-nitro-1H-pyrrol-2-yl)- (9CI)
Ethanone, 1-(1-nitro-1H-pyrrol-2-yl)- (9CI) structure
|
Common Name | Ethanone, 1-(1-nitro-1H-pyrrol-2-yl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 158366-45-1 | Molecular Weight | 154.12300 | |
| Density | 1.36g/cm3 | Boiling Point | 322.4ºC at 760mmHg | |
| Molecular Formula | C6H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.8ºC | |
Summary: 1-(1-Nitro-1H-pyrrol-2-yl)ethanone (CAS号: 158366-45-1, molecular formula: C6H6N2O3, molecular weight: 154.12300, boiling point: 322.4°C, density: 1.36g/cm³. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(1-nitropyrrol-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 322.4ºC at 760mmHg |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12300 |
| Flash Point | 148.8ºC |
| Exact Mass | 154.03800 |
| PSA | 67.82000 |
| LogP | 1.25370 |
| Vapour Pressure | 0.00028mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | IAWKNFOCXFSSLA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccn1[N+](=O)[O-] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethanone,1-(1-nitro-1H-pyrrol-2-yl) |
| 1-(1-Nitro-1H-pyrrol-2-yl)ethanone |
| 1-Nitro-2-acetylpyrrole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: Molecular weight of 1-(1-nitropyrrol-2-yl)ethanone is 154.12300. |
| Q: What English synonyms does 1-(1-nitropyrrol-2-yl)ethanone have? |
| A: English synonyms of 1-(1-nitropyrrol-2-yl)ethanone: Ethanone,1-(1-nitro-1H-pyrrol-2-yl), 1-(1-Nitro-1H-pyrrol-2-yl)ethanone, 1-Nitro-2-acetylpyrrole. |
| Q: What is the English name of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: The English name of 1-(1-nitropyrrol-2-yl)ethanone is 1-(1-nitropyrrol-2-yl)ethanone. |
| Q: What is the polar surface area (PSA) of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: Polar surface area (PSA) of 1-(1-nitropyrrol-2-yl)ethanone is 67.82000. |
| Q: What is the Chinese name of 158366-45-1? |
| A: Chinese name of 158366-45-1 is 158366-45-1. |
| Q: What is the InChIKey of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: InChIKey of 1-(1-nitropyrrol-2-yl)ethanone is IAWKNFOCXFSSLA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: Molecular formula of 1-(1-nitropyrrol-2-yl)ethanone is C6H6N2O3. |
| Q: What is the boiling point of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: Boiling point of 1-(1-nitropyrrol-2-yl)ethanone is 322.4ºC at 760mmHg. |
| Q: What is the LogP of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: LogP of 1-(1-nitropyrrol-2-yl)ethanone is 1.25370. |
| Q: What is the CAS number of 1-(1-nitropyrrol-2-yl)ethanone? |
| A: CAS number of 1-(1-nitropyrrol-2-yl)ethanone is 158366-45-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |