3-Oxobutanoic acid 1-ethylcyclohexyl ester
Modify Date: 2025-09-21 14:30:33
3-Oxobutanoic acid 1-ethylcyclohexyl ester structure
|
Common Name | 3-Oxobutanoic acid 1-ethylcyclohexyl ester | ||
|---|---|---|---|---|
| CAS Number | 15780-56-0 | Molecular Weight | 212.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-ethylcyclohexyl) 3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20O3 |
|---|---|
| Molecular Weight | 212.28500 |
| Exact Mass | 212.14100 |
| PSA | 43.37000 |
| LogP | 2.62160 |
| InChIKey | AOJQJEGJPJOEOG-UHFFFAOYSA-N |
| SMILES | CCC1(OC(=O)CC(C)=O)CCCCC1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Acetessigsaeure-(1-aethyl-cyclohexyl-ester) |
| 3-Oxobutanoic acid 1-ethylcyclohexyl ester |
| 3-Oxo-buttersaeure-<1-aethyl-cyclohexylester> |
| 1-Ethylcyclohexyl 3-oxobutanoate |
| Acetoacetic acid,1-ethylcyclohexyl ester |