Pitnot-2
Modify Date: 2025-11-18 06:20:45
Pitnot-2 structure
|
Common Name | Pitnot-2 | ||
|---|---|---|---|---|
| CAS Number | 1576239-29-6 | Molecular Weight | 409.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H13BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pitnot-2Pitnot-2 is an inactive analog of clathrin inhibitor Pitstop 2. Pitnot-2 can be used as negative control[1]. |
| Name | Pitnot-2 |
|---|
| Description | Pitnot-2 is an inactive analog of clathrin inhibitor Pitstop 2. Pitnot-2 can be used as negative control[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H13BrN2OS |
|---|---|
| Molecular Weight | 409.30 |
| InChIKey | KYPNGYSNEKASBN-PDGQHHTCSA-N |
| SMILES | O=C1NC(=Nc2cccc3ccccc23)SC1=Cc1ccc(Br)cc1 |