Benzamide, N,N'-methylenebis- structure
|
Common Name | Benzamide, N,N'-methylenebis- | ||
|---|---|---|---|---|
| CAS Number | 1575-94-6 | Molecular Weight | 254.28400 | |
| Density | 1.185g/cm3 | Boiling Point | 569.4ºC at 760mmHg | |
| Molecular Formula | C15H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | N-(benzamidomethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 569.4ºC at 760mmHg |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.28400 |
| Flash Point | 235.4ºC |
| Exact Mass | 254.10600 |
| PSA | 58.20000 |
| LogP | 2.58570 |
| Vapour Pressure | 5.61E-13mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | IOSFAIUBCYDISE-UHFFFAOYSA-N |
| SMILES | O=C(NCNC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-methylenedibenzamide |
| Benzamide,N,N'-methylenebis |
| methylenebisbenzamide |
| N,N'dibenzoylmethanediamine |